C23H28N4OS — CID 45189074
5-(1H-imidazol-2-yl)-N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]thiophene-2-carboxamide (PubChem CID 45189074) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 5-(1H-imidazol-2-yl)-N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-(1H-imidazol-2-yl)-N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45189074 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 5-(1H-imidazol-2-yl)-N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]thiophene-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(-c2ncc[nH]2)s1)C1CCCN(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N4OS/c1-26(23(28)21-12-11-20(29-21)22-24-13-14-25-22)19-10-6-16-27(17-19)15-5-9-18-7-3-2-4-8-18/h2-4,7-8,11-14,19H,5-6,9-10,15-17H2,1H3,(H,24,25) |
| InChIKey | FEQKHYHHVFAVJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |