C22H32N2OS — CID 45190351
N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-(thiophen-3-ylmethyl)ethanamine (PubChem CID 45190351) has the molecular formula C22H32N2OS and a molecular weight of 372.58 g/mol. Its IUPAC name is N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-(thiophen-3-ylmethyl)ethanamine.
| Compound Name | N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-(thiophen-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 45190351 |
| Molecular Formula | C22H32N2OS |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[[1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methyl]-N-(thiophen-3-ylmethyl)ethanamine |
| SMILES | CCN(Cc1ccsc1)CC1CCCN(CCc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C22H32N2OS/c1-3-23(17-21-10-13-26-18-21)15-20-7-5-11-24(16-20)12-9-19-6-4-8-22(14-19)25-2/h4,6,8,10,13-14,18,20H,3,5,7,9,11-12,15-17H2,1-2H3 |
| InChIKey | GKDRDQFBAIXGIS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |