C19H24N2O2 — CID 45195094
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3,6,7-trimethyl-1-benzofuran-2-yl)methanone (PubChem CID 45195094) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3,6,7-trimethyl-1-benzofuran-2-yl)methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3,6,7-trimethyl-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 45195094 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3,6,7-trimethyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1ccc2c(C)c(C(=O)N3CCN4CCCC4C3)oc2c1C |
| InChI | InChI=1S/C19H24N2O2/c1-12-6-7-16-14(3)18(23-17(16)13(12)2)19(22)21-10-9-20-8-4-5-15(20)11-21/h6-7,15H,4-5,8-11H2,1-3H3 |
| InChIKey | RCBIPKPBMHPJTK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |