C16H19NO2 — CID 26394079
N-cyclobutyl-3,6,7-trimethyl-1-benzofuran-2-carboxamide (PubChem CID 26394079) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-cyclobutyl-3,6,7-trimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-cyclobutyl-3,6,7-trimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 26394079 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-cyclobutyl-3,6,7-trimethyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2c(C)c(C(=O)NC3CCC3)oc2c1C |
| InChI | InChI=1S/C16H19NO2/c1-9-7-8-13-11(3)15(19-14(13)10(9)2)16(18)17-12-5-4-6-12/h7-8,12H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | LDNQLZBNWSKTPG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |