C22H24N2O3 — CID 86834650
N-[3-(cyclopentylamino)-3-oxopropyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide (PubChem CID 86834650) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is N-[3-(cyclopentylamino)-3-oxopropyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N-[3-(cyclopentylamino)-3-oxopropyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 86834650 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[3-(cyclopentylamino)-3-oxopropyl]-3-methylbenzo[g][1]benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCC(=O)NC2CCCC2)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C22H24N2O3/c1-14-17-11-10-15-6-2-5-9-18(15)21(17)27-20(14)22(26)23-13-12-19(25)24-16-7-3-4-8-16/h2,5-6,9-11,16H,3-4,7-8,12-13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | DSXWPSXCRBABLG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |