C22H22N4O3 — CID 45200993
1-[3-[[3-(2-pyridin-2-ylpyrrolidine-1-carbonyl)-1H-pyrazol-5-yl]methoxy]phenyl]ethanone (PubChem CID 45200993) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[3-[[3-(2-pyridin-2-ylpyrrolidine-1-carbonyl)-1H-pyrazol-5-yl]methoxy]phenyl]ethanone.
| Compound Name | 1-[3-[[3-(2-pyridin-2-ylpyrrolidine-1-carbonyl)-1H-pyrazol-5-yl]methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 45200993 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[3-[[3-(2-pyridin-2-ylpyrrolidine-1-carbonyl)-1H-pyrazol-5-yl]methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(OCc2cc(C(=O)N3CCCC3c3ccccn3)n[nH]2)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-15(27)16-6-4-7-18(12-16)29-14-17-13-20(25-24-17)22(28)26-11-5-9-21(26)19-8-2-3-10-23-19/h2-4,6-8,10,12-13,21H,5,9,11,14H2,1H3,(H,24,25) |
| InChIKey | SXJRGWUPHHILPC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |