C24H34N6O — CID 45207371
N-cyclopropyl-1-[2-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-2-yl]ethyl]triazole-4-carboxamide (PubChem CID 45207371) has the molecular formula C24H34N6O and a molecular weight of 422.58 g/mol. Its IUPAC name is N-cyclopropyl-1-[2-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-2-yl]ethyl]triazole-4-carboxamide.
| Compound Name | N-cyclopropyl-1-[2-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-2-yl]ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 45207371 |
| Molecular Formula | C24H34N6O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | N-cyclopropyl-1-[2-[1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enyl]piperidin-2-yl]ethyl]triazole-4-carboxamide |
| SMILES | CN(C)c1ccc(/C=C/CN2CCCCC2CCn2cc(C(=O)NC3CC3)nn2)cc1 |
| InChI | InChI=1S/C24H34N6O/c1-28(2)21-12-8-19(9-13-21)6-5-16-29-15-4-3-7-22(29)14-17-30-18-23(26-27-30)24(31)25-20-10-11-20/h5-6,8-9,12-13,18,20,22H,3-4,7,10-11,14-17H2,1-2H3,(H,25,31)/b6-5+ |
| InChIKey | BTBDANZYFFLMHW-AATRIKPKSA-N |
| XLogP | 3.19 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|