C15H27N3O4S — CID 45210868
3-[(dimethylsulfamoylamino)methyl]-1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidine (PubChem CID 45210868) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-[(dimethylsulfamoylamino)methyl]-1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidine.
| Compound Name | 3-[(dimethylsulfamoylamino)methyl]-1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidine |
|---|---|
| PubChem CID | 45210868 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-[(dimethylsulfamoylamino)methyl]-1-[[5-(methoxymethyl)furan-2-yl]methyl]piperidine |
| SMILES | COCc1ccc(CN2CCCC(CNS(=O)(=O)N(C)C)C2)o1 |
| InChI | InChI=1S/C15H27N3O4S/c1-17(2)23(19,20)16-9-13-5-4-8-18(10-13)11-14-6-7-15(22-14)12-21-3/h6-7,13,16H,4-5,8-12H2,1-3H3 |
| InChIKey | WDXIMTZLGYYRJY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |