C23H39N3O2 — CID 45211246
1-[cyclohexyl(methyl)amino]-3-[3-[(4-ethylpiperazin-1-yl)methyl]phenoxy]propan-2-ol (PubChem CID 45211246) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is 1-[cyclohexyl(methyl)amino]-3-[3-[(4-ethylpiperazin-1-yl)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[cyclohexyl(methyl)amino]-3-[3-[(4-ethylpiperazin-1-yl)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45211246 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | 1-[cyclohexyl(methyl)amino]-3-[3-[(4-ethylpiperazin-1-yl)methyl]phenoxy]propan-2-ol |
| SMILES | CCN1CCN(Cc2cccc(OCC(O)CN(C)C3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C23H39N3O2/c1-3-25-12-14-26(15-13-25)17-20-8-7-11-23(16-20)28-19-22(27)18-24(2)21-9-5-4-6-10-21/h7-8,11,16,21-22,27H,3-6,9-10,12-15,17-19H2,1-2H3 |
| InChIKey | WSQGDUKZGMPSPP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |