C22H35N3OS — CID 45217294
N-benzyl-1-[1-(3-methylsulfanylpropyl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 45217294) has the molecular formula C22H35N3OS and a molecular weight of 389.61 g/mol. Its IUPAC name is N-benzyl-1-[1-(3-methylsulfanylpropyl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-benzyl-1-[1-(3-methylsulfanylpropyl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45217294 |
| Molecular Formula | C22H35N3OS |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-benzyl-1-[1-(3-methylsulfanylpropyl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | CSCCCN1CCC(N2CCCC(C(=O)NCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C22H35N3OS/c1-27-16-6-12-24-14-10-21(11-15-24)25-13-5-9-20(18-25)22(26)23-17-19-7-3-2-4-8-19/h2-4,7-8,20-21H,5-6,9-18H2,1H3,(H,23,26) |
| InChIKey | KVOIFPGYQSIIOO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|