C22H27N3O2 — CID 45222808
[9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-(1-oxidopyridin-1-ium-3-yl)methanone (PubChem CID 45222808) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is [9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-(1-oxidopyridin-1-ium-3-yl)methanone.
| Compound Name | [9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-(1-oxidopyridin-1-ium-3-yl)methanone |
|---|---|
| PubChem CID | 45222808 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | [9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-(1-oxidopyridin-1-ium-3-yl)methanone |
| SMILES | Cc1cccc(CN2CCCC3(CCN(C(=O)c4ccc[n+]([O-])c4)C3)C2)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-18-5-2-6-19(13-18)14-23-10-4-8-22(16-23)9-12-24(17-22)21(26)20-7-3-11-25(27)15-20/h2-3,5-7,11,13,15H,4,8-10,12,14,16-17H2,1H3 |
| InChIKey | AFRAGMLQSBRKIF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|