C21H28N4O3 — CID 95712520
3-[2-[(5S)-9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 95712520) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-[2-[(5S)-9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[(5S)-9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95712520 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3-[2-[(5S)-9-[(3-methylphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(CN2CCC[C@]3(CCN(C(=O)CN4C(=O)CNC4=O)C3)C2)c1 |
| InChI | InChI=1S/C21H28N4O3/c1-16-4-2-5-17(10-16)12-23-8-3-6-21(14-23)7-9-24(15-21)19(27)13-25-18(26)11-22-20(25)28/h2,4-5,10H,3,6-9,11-15H2,1H3,(H,22,28)/t21-/m0/s1 |
| InChIKey | BRXWUVHDOKLYBC-NRFANRHFSA-N |
| XLogP | 1.36 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|