C18H31N3O4S — CID 45228162
ethyl 1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidine-2-carboxylate (PubChem CID 45228162) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is ethyl 1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 45228162 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | ethyl 1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidine-2-carboxylate |
| SMILES | CCCCn1c(CN2CCCCC2C(=O)OCC)cnc1S(=O)(=O)CC |
| InChI | InChI=1S/C18H31N3O4S/c1-4-7-12-21-15(13-19-18(21)26(23,24)6-3)14-20-11-9-8-10-16(20)17(22)25-5-2/h13,16H,4-12,14H2,1-3H3 |
| InChIKey | SKJBWCJVMIGEBJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |