C17H29N3O5S — CID 42097669
ethyl 1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidine-4-carboxylate (PubChem CID 42097669) has the molecular formula C17H29N3O5S and a molecular weight of 387.50 g/mol. Its IUPAC name is ethyl 1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42097669 |
| Molecular Formula | C17H29N3O5S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2cnc(S(C)(=O)=O)n2CCCOC)CC1 |
| InChI | InChI=1S/C17H29N3O5S/c1-4-25-16(21)14-6-9-19(10-7-14)13-15-12-18-17(26(3,22)23)20(15)8-5-11-24-2/h12,14H,4-11,13H2,1-3H3 |
| InChIKey | UOWYMFYLASCRTF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|