C15H16ClN3O4 — CID 45228933
3-[2-[2-[(2-chlorophenyl)methyl]morpholin-4-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate (PubChem CID 45228933) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is 3-[2-[2-[(2-chlorophenyl)methyl]morpholin-4-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-[2-[2-[(2-chlorophenyl)methyl]morpholin-4-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 45228933 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[2-[2-[(2-chlorophenyl)methyl]morpholin-4-yl]-2-oxoethyl]oxadiazol-3-ium-5-olate |
| SMILES | O=C(C[n+]1cc([O-])on1)N1CCOC(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H16ClN3O4/c16-13-4-2-1-3-11(13)7-12-8-18(5-6-22-12)14(20)9-19-10-15(21)23-17-19/h1-4,10,12H,5-9H2 |
| InChIKey | SKSJZCIYPGMPPY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|