C16H22FNO2 — CID 45239153
4-[[3-(3-fluorophenyl)oxolan-3-yl]methyl]-1,4-oxazepane (PubChem CID 45239153) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 4-[[3-(3-fluorophenyl)oxolan-3-yl]methyl]-1,4-oxazepane.
| Compound Name | 4-[[3-(3-fluorophenyl)oxolan-3-yl]methyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 45239153 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-[[3-(3-fluorophenyl)oxolan-3-yl]methyl]-1,4-oxazepane |
| SMILES | Fc1cccc(C2(CN3CCCOCC3)CCOC2)c1 |
| InChI | InChI=1S/C16H22FNO2/c17-15-4-1-3-14(11-15)16(5-9-20-13-16)12-18-6-2-8-19-10-7-18/h1,3-4,11H,2,5-10,12-13H2 |
| InChIKey | ZBDCVDQUUUMDKB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |