C28H29ClN2O5 — CID 45241176
5-chloro-N-[[3-(furan-2-ylmethoxy)-4-methoxyphenyl]methyl]-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 45241176) has the molecular formula C28H29ClN2O5 and a molecular weight of 509.00 g/mol. Its IUPAC name is 5-chloro-N-[[3-(furan-2-ylmethoxy)-4-methoxyphenyl]methyl]-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-(furan-2-ylmethoxy)-4-methoxyphenyl]methyl]-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 45241176 |
| Molecular Formula | C28H29ClN2O5 |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 5-chloro-N-[[3-(furan-2-ylmethoxy)-4-methoxyphenyl]methyl]-3-methyl-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | COc1ccc(CN(CC2CCCO2)C(=O)c2[nH]c3ccc(Cl)cc3c2C)cc1OCc1ccco1 |
| InChI | InChI=1S/C28H29ClN2O5/c1-18-23-14-20(29)8-9-24(23)30-27(18)28(32)31(16-21-5-3-11-34-21)15-19-7-10-25(33-2)26(13-19)36-17-22-6-4-12-35-22/h4,6-10,12-14,21,30H,3,5,11,15-17H2,1-2H3 |
| InChIKey | BYYPXHCCNRAJJY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 76.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|