C17H27ClN4 — CID 45241671
1-(5-chloro-2-pyridinyl)-4-[(1-ethylpiperidin-2-yl)methyl]piperazine (PubChem CID 45241671) has the molecular formula C17H27ClN4 and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-4-[(1-ethylpiperidin-2-yl)methyl]piperazine.
| Compound Name | 1-(5-chloro-2-pyridinyl)-4-[(1-ethylpiperidin-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 45241671 |
| Molecular Formula | C17H27ClN4 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-4-[(1-ethylpiperidin-2-yl)methyl]piperazine |
| SMILES | CCN1CCCCC1CN1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H27ClN4/c1-2-21-8-4-3-5-16(21)14-20-9-11-22(12-10-20)17-7-6-15(18)13-19-17/h6-7,13,16H,2-5,8-12,14H2,1H3 |
| InChIKey | QXPBYCCHBYLJFB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |