C25H35NO5S — CID 4524908
[2,4-bis(2-methylbutan-2-yl)phenyl] 3-acetamido-4-methoxybenzenesulfonate (PubChem CID 4524908) has the molecular formula C25H35NO5S and a molecular weight of 461.62 g/mol. Its IUPAC name is [2,4-bis(2-methylbutan-2-yl)phenyl] 3-acetamido-4-methoxybenzenesulfonate.
| Compound Name | [2,4-bis(2-methylbutan-2-yl)phenyl] 3-acetamido-4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 4524908 |
| Molecular Formula | C25H35NO5S |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [2,4-bis(2-methylbutan-2-yl)phenyl] 3-acetamido-4-methoxybenzenesulfonate |
| SMILES | CCC(C)(C)c1ccc(OS(=O)(=O)c2ccc(OC)c(NC(C)=O)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C25H35NO5S/c1-9-24(4,5)18-11-13-22(20(15-18)25(6,7)10-2)31-32(28,29)19-12-14-23(30-8)21(16-19)26-17(3)27/h11-16H,9-10H2,1-8H3,(H,26,27) |
| InChIKey | NKOICDUJTZOBOU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|