About ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate
ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate (PubChem CID 45250093) has the molecular formula C17H23F2NO4S
and a molecular weight of 375.44 g/mol. Its IUPAC name is ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate |
| PubChem CID | 45250093 |
| Molecular Formula | C17H23F2NO4S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(F)cc2F)CCCN(S(=O)(=O)CC)C1 |
| InChI | InChI=1S/C17H23F2NO4S/c1-3-24-16(21)17(11-13-6-7-14(18)10-15(13)19)8-5-9-20(12-17)25(22,23)4-2/h6-7,10H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | YFGHWBKLFIJNCO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate?
The IUPAC name of ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate (CID 45250093) is ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate.
What is the SMILES notation for ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate?
The canonical SMILES for ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate is CCOC(=O)C1(Cc2ccc(F)cc2F)CCCN(S(=O)(=O)CC)C1.
What is the InChIKey of ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate?
The InChIKey is YFGHWBKLFIJNCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F2NO4S/c1-3-24-16(21)17(11-13-6-7-14(18)10-15(13)19)8-5-9-20(12-17)25(22,23)4-2/h6-7,10H,3-5,8-9,11-12H2,1-2H3.
What are the key properties of ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate?
ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate has a molecular weight of 375.44 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2,4-difluorophenyl)methyl]-1-ethylsulfonylpiperidine-3-carboxylate is sourced from PubChem (CID 45250093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).