C20H28F2N2O3 — CID 26411465
ethyl (3S)-1-(butylcarbamoyl)-3-[(2,4-difluorophenyl)methyl]piperidine-3-carboxylate (PubChem CID 26411465) has the molecular formula C20H28F2N2O3 and a molecular weight of 382.45 g/mol. Its IUPAC name is ethyl (3S)-1-(butylcarbamoyl)-3-[(2,4-difluorophenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(butylcarbamoyl)-3-[(2,4-difluorophenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26411465 |
| Molecular Formula | C20H28F2N2O3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethyl (3S)-1-(butylcarbamoyl)-3-[(2,4-difluorophenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCCCNC(=O)N1CCC[C@@](Cc2ccc(F)cc2F)(C(=O)OCC)C1 |
| InChI | InChI=1S/C20H28F2N2O3/c1-3-5-10-23-19(26)24-11-6-9-20(14-24,18(25)27-4-2)13-15-7-8-16(21)12-17(15)22/h7-8,12H,3-6,9-11,13-14H2,1-2H3,(H,23,26)/t20-/m0/s1 |
| InChIKey | HYZBPQWGXZBIKY-FQEVSTJZSA-N |
| XLogP | 3.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|