C21H21F2NO5 — CID 45230018
ethyl 3-[(2,4-difluorophenyl)methyl]-1-[2-(furan-2-yl)-2-oxoacetyl]piperidine-3-carboxylate (PubChem CID 45230018) has the molecular formula C21H21F2NO5 and a molecular weight of 405.40 g/mol. Its IUPAC name is ethyl 3-[(2,4-difluorophenyl)methyl]-1-[2-(furan-2-yl)-2-oxoacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 3-[(2,4-difluorophenyl)methyl]-1-[2-(furan-2-yl)-2-oxoacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45230018 |
| Molecular Formula | C21H21F2NO5 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | ethyl 3-[(2,4-difluorophenyl)methyl]-1-[2-(furan-2-yl)-2-oxoacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(F)cc2F)CCCN(C(=O)C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C21H21F2NO5/c1-2-28-20(27)21(12-14-6-7-15(22)11-16(14)23)8-4-9-24(13-21)19(26)18(25)17-5-3-10-29-17/h3,5-7,10-11H,2,4,8-9,12-13H2,1H3 |
| InChIKey | VISFWJXYEVIMBT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|