C23H23F2NO4 — CID 25458532
ethyl (3S)-3-[(2,4-difluorophenyl)methyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxylate (PubChem CID 25458532) has the molecular formula C23H23F2NO4 and a molecular weight of 415.44 g/mol. Its IUPAC name is ethyl (3S)-3-[(2,4-difluorophenyl)methyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-[(2,4-difluorophenyl)methyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 25458532 |
| Molecular Formula | C23H23F2NO4 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl (3S)-3-[(2,4-difluorophenyl)methyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccc(F)cc2F)CCCN(C(=O)C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C23H23F2NO4/c1-2-30-22(29)23(14-17-9-10-18(24)13-19(17)25)11-6-12-26(15-23)21(28)20(27)16-7-4-3-5-8-16/h3-5,7-10,13H,2,6,11-12,14-15H2,1H3/t23-/m0/s1 |
| InChIKey | ZRXMRKAYWHLURB-QHCPKHFHSA-N |
| XLogP | 3.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|