C20H28N4O3 — CID 45257096
(2S,3S)-N-[[4-(5-hexyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-3-hydroxypyrrolidine-2-carboxamide (PubChem CID 45257096) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2S,3S)-N-[[4-(5-hexyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-3-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-N-[[4-(5-hexyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-3-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45257096 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (2S,3S)-N-[[4-(5-hexyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-3-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCCCCCc1nc(-c2ccc(CNC(=O)[C@H]3NCC[C@@H]3O)cc2)no1 |
| InChI | InChI=1S/C20H28N4O3/c1-2-3-4-5-6-17-23-19(24-27-17)15-9-7-14(8-10-15)13-22-20(26)18-16(25)11-12-21-18/h7-10,16,18,21,25H,2-6,11-13H2,1H3,(H,22,26)/t16-,18-/m0/s1 |
| InChIKey | VCAYIZQMMNEPHI-WMZOPIPTSA-N |
| XLogP | 2.20 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|