C24H16N6O2S — CID 45257526
2-[(1S)-2-phenyl-1-(3-pyridin-4-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione (PubChem CID 45257526) has the molecular formula C24H16N6O2S and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[(1S)-2-phenyl-1-(3-pyridin-4-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-2-phenyl-1-(3-pyridin-4-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45257526 |
| Molecular Formula | C24H16N6O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-[(1S)-2-phenyl-1-(3-pyridin-4-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H](Cc1ccccc1)c1nn2c(-c3ccncc3)nnc2s1 |
| InChI | InChI=1S/C24H16N6O2S/c31-22-17-8-4-5-9-18(17)23(32)29(22)19(14-15-6-2-1-3-7-15)21-28-30-20(26-27-24(30)33-21)16-10-12-25-13-11-16/h1-13,19H,14H2/t19-/m0/s1 |
| InChIKey | RVSSAITVCMUITA-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 93.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|