C22H18N4O3S — CID 45258128
4-[2-(4-methoxyphenyl)-4H-imidazo[4,5-b]indol-3-yl]benzenesulfonamide (PubChem CID 45258128) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)-4H-imidazo[4,5-b]indol-3-yl]benzenesulfonamide.
| Compound Name | 4-[2-(4-methoxyphenyl)-4H-imidazo[4,5-b]indol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 45258128 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)-4H-imidazo[4,5-b]indol-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2nc3c4ccccc4[nH]c3n2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H18N4O3S/c1-29-16-10-6-14(7-11-16)21-25-20-18-4-2-3-5-19(18)24-22(20)26(21)15-8-12-17(13-9-15)30(23,27)28/h2-13,24H,1H3,(H2,23,27,28) |
| InChIKey | NTEQRILLYUUTMQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |