C16H25NO2Si — CID 45258748
methyl (1R,4R,6S)-2-(4-trimethylsilylbut-3-ynyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate (PubChem CID 45258748) has the molecular formula C16H25NO2Si and a molecular weight of 291.47 g/mol. Its IUPAC name is methyl (1R,4R,6S)-2-(4-trimethylsilylbut-3-ynyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate.
| Compound Name | methyl (1R,4R,6S)-2-(4-trimethylsilylbut-3-ynyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
|---|---|
| PubChem CID | 45258748 |
| Molecular Formula | C16H25NO2Si |
| Molecular Weight | 291.47 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | methyl (1R,4R,6S)-2-(4-trimethylsilylbut-3-ynyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]2C=C[C@H]1N(CCC#C[Si](C)(C)C)C2 |
| InChI | InChI=1S/C16H25NO2Si/c1-19-16(18)14-11-13-7-8-15(14)17(12-13)9-5-6-10-20(2,3)4/h7-8,13-15H,5,9,11-12H2,1-4H3/t13-,14-,15+/m0/s1 |
| InChIKey | HCNAGOFCJQGWCY-SOUVJXGZSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|