C23H40O6Si — CID 45258843
methyl (2E,4S)-4-[[(3R,7S)-7-acetyloxyoct-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhexa-2,5-dienoate (PubChem CID 45258843) has the molecular formula C23H40O6Si and a molecular weight of 440.65 g/mol. Its IUPAC name is methyl (2E,4S)-4-[[(3R,7S)-7-acetyloxyoct-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhexa-2,5-dienoate.
| Compound Name | methyl (2E,4S)-4-[[(3R,7S)-7-acetyloxyoct-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhexa-2,5-dienoate |
|---|---|
| PubChem CID | 45258843 |
| Molecular Formula | C23H40O6Si |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | methyl (2E,4S)-4-[[(3R,7S)-7-acetyloxyoct-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhexa-2,5-dienoate |
| SMILES | C=C[C@@H](/C=C/C(=O)OC)O[Si](O[C@@H](C=C)CCC[C@H](C)OC(C)=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H40O6Si/c1-10-21(14-12-13-19(7)27-20(8)24)28-30(17(3)4,18(5)6)29-22(11-2)15-16-23(25)26-9/h10-11,15-19,21-22H,1-2,12-14H2,3-9H3/b16-15+/t19-,21-,22-/m0/s1 |
| InChIKey | GSDOQIYVTZDMFE-LHRSKVCBSA-N |
| XLogP | 5.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|