C27H52O6Si2 — CID 45258845
methyl (2E,4S,5Z,7R,11S)-11-acetyloxy-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,5-dienoate (PubChem CID 45258845) has the molecular formula C27H52O6Si2 and a molecular weight of 528.88 g/mol. Its IUPAC name is methyl (2E,4S,5Z,7R,11S)-11-acetyloxy-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,5-dienoate.
| Compound Name | methyl (2E,4S,5Z,7R,11S)-11-acetyloxy-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,5-dienoate |
|---|---|
| PubChem CID | 45258845 |
| Molecular Formula | C27H52O6Si2 |
| Molecular Weight | 528.88 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | methyl (2E,4S,5Z,7R,11S)-11-acetyloxy-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,5-dienoate |
| SMILES | COC(=O)/C=C/[C@H](/C=C\[C@@H](CCC[C@H](C)OC(C)=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O6Si2/c1-21(31-22(2)28)15-14-16-23(32-34(10,11)26(3,4)5)17-18-24(19-20-25(29)30-9)33-35(12,13)27(6,7)8/h17-21,23-24H,14-16H2,1-13H3/b18-17-,20-19+/t21-,23+,24-/m0/s1 |
| InChIKey | PKFFOJXNXDCCPS-JCODZCQBSA-N |
| XLogP | 7.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.88 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|