C10H15Cl2NO — CID 45259793
2-(aminomethyl)-6-chloro-3,4,5-trimethylphenol;hydrochloride (PubChem CID 45259793) has the molecular formula C10H15Cl2NO and a molecular weight of 236.14 g/mol. Its IUPAC name is 2-(aminomethyl)-6-chloro-3,4,5-trimethylphenol;hydrochloride.
| Compound Name | 2-(aminomethyl)-6-chloro-3,4,5-trimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 45259793 |
| Molecular Formula | C10H15Cl2NO |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(aminomethyl)-6-chloro-3,4,5-trimethylphenol;hydrochloride |
| SMILES | Cc1c(C)c(Cl)c(O)c(CN)c1C.Cl |
| InChI | InChI=1S/C10H14ClNO.ClH/c1-5-6(2)8(4-12)10(13)9(11)7(5)3;/h13H,4,12H2,1-3H3;1H |
| InChIKey | CTAWLUTYIGIHGY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|