C17H25ClN2O4 — CID 45262301
[4-(aminomethyl)cyclohexanecarbonyl]oxymethyl 4-(aminomethyl)benzoate;hydrochloride (PubChem CID 45262301) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is [4-(aminomethyl)cyclohexanecarbonyl]oxymethyl 4-(aminomethyl)benzoate;hydrochloride.
| Compound Name | [4-(aminomethyl)cyclohexanecarbonyl]oxymethyl 4-(aminomethyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 45262301 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [4-(aminomethyl)cyclohexanecarbonyl]oxymethyl 4-(aminomethyl)benzoate;hydrochloride |
| SMILES | Cl.NCc1ccc(C(=O)OCOC(=O)C2CCC(CN)CC2)cc1 |
| InChI | InChI=1S/C17H24N2O4.ClH/c18-9-12-1-5-14(6-2-12)16(20)22-11-23-17(21)15-7-3-13(10-19)4-8-15;/h1-2,5-6,13,15H,3-4,7-11,18-19H2;1H |
| InChIKey | FUPKHQJCUPTMCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|