About cyanomethyl 4-(aminomethyl)benzoate
cyanomethyl 4-(aminomethyl)benzoate (PubChem CID 155382796) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is cyanomethyl 4-(aminomethyl)benzoate.
Molecular Properties
| Compound Name | cyanomethyl 4-(aminomethyl)benzoate |
| PubChem CID | 155382796 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | cyanomethyl 4-(aminomethyl)benzoate |
| SMILES | N#CCOC(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C10H10N2O2/c11-5-6-14-10(13)9-3-1-8(7-12)2-4-9/h1-4H,6-7,12H2 |
| InChIKey | XFFHJKQUBXWQFL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyanomethyl 4-(aminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 4-(aminomethyl)benzoate?
The IUPAC name of cyanomethyl 4-(aminomethyl)benzoate (CID 155382796) is cyanomethyl 4-(aminomethyl)benzoate.
What is the SMILES notation for cyanomethyl 4-(aminomethyl)benzoate?
The canonical SMILES for cyanomethyl 4-(aminomethyl)benzoate is N#CCOC(=O)c1ccc(CN)cc1.
What is the InChIKey of cyanomethyl 4-(aminomethyl)benzoate?
The InChIKey is XFFHJKQUBXWQFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c11-5-6-14-10(13)9-3-1-8(7-12)2-4-9/h1-4H,6-7,12H2.
What are the key properties of cyanomethyl 4-(aminomethyl)benzoate?
cyanomethyl 4-(aminomethyl)benzoate has a molecular weight of 190.20 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 4-(aminomethyl)benzoate is sourced from PubChem (CID 155382796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).