C27H32N6O6S2 — CID 4526786
ethyl 2-[[2-[[4-butyl-5-[[(4-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4526786) has the molecular formula C27H32N6O6S2 and a molecular weight of 600.72 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-butyl-5-[[(4-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-butyl-5-[[(4-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4526786 |
| Molecular Formula | C27H32N6O6S2 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | ethyl 2-[[2-[[4-butyl-5-[[(4-nitrobenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCCn1c(CNC(=O)c2ccc([N+](=O)[O-])cc2)nnc1SCC(=O)Nc1sc2c(c1C(=O)OCC)CCCC2 |
| InChI | InChI=1S/C27H32N6O6S2/c1-3-5-14-32-21(15-28-24(35)17-10-12-18(13-11-17)33(37)38)30-31-27(32)40-16-22(34)29-25-23(26(36)39-4-2)19-8-6-7-9-20(19)41-25/h10-13H,3-9,14-16H2,1-2H3,(H,28,35)(H,29,34) |
| InChIKey | ROHUWGBCXFEJCT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|