C30H29FN6O6S2 — CID 3414682
ethyl 2-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 3414682) has the molecular formula C30H29FN6O6S2 and a molecular weight of 652.73 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3414682 |
| Molecular Formula | C30H29FN6O6S2 |
| Molecular Weight | 652.73 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | ethyl 2-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(CNC(=O)c3ccccc3F)n2-c2ccc([N+](=O)[O-])cc2)sc2c1CCCCC2 |
| InChI | InChI=1S/C30H29FN6O6S2/c1-2-43-29(40)26-21-9-4-3-5-11-23(21)45-28(26)33-25(38)17-44-30-35-34-24(16-32-27(39)20-8-6-7-10-22(20)31)36(30)18-12-14-19(15-13-18)37(41)42/h6-8,10,12-15H,2-5,9,11,16-17H2,1H3,(H,32,39)(H,33,38) |
| InChIKey | UKGYVUGVIGFBAA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|