C27H26BrN5O5S2 — CID 3434163
ethyl 2-[[2-[[4-(4-bromophenyl)-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3434163) has the molecular formula C27H26BrN5O5S2 and a molecular weight of 644.57 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-(4-bromophenyl)-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-(4-bromophenyl)-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3434163 |
| Molecular Formula | C27H26BrN5O5S2 |
| Molecular Weight | 644.57 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | ethyl 2-[[2-[[4-(4-bromophenyl)-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(CNC(=O)c3ccco3)n2-c2ccc(Br)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H26BrN5O5S2/c1-2-37-26(36)23-18-6-3-4-8-20(18)40-25(23)30-22(34)15-39-27-32-31-21(14-29-24(35)19-7-5-13-38-19)33(27)17-11-9-16(28)10-12-17/h5,7,9-13H,2-4,6,8,14-15H2,1H3,(H,29,35)(H,30,34) |
| InChIKey | SLQQLKSGQFCMEB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |