C27H33N5O5S2 — CID 4520087
ethyl 2-[[2-[[4-cyclohexyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4520087) has the molecular formula C27H33N5O5S2 and a molecular weight of 571.73 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-cyclohexyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-cyclohexyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4520087 |
| Molecular Formula | C27H33N5O5S2 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | ethyl 2-[[2-[[4-cyclohexyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(CNC(=O)c3ccco3)n2C2CCCCC2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H33N5O5S2/c1-2-36-26(35)23-18-11-6-7-13-20(18)39-25(23)29-22(33)16-38-27-31-30-21(32(27)17-9-4-3-5-10-17)15-28-24(34)19-12-8-14-37-19/h8,12,14,17H,2-7,9-11,13,15-16H2,1H3,(H,28,34)(H,29,33) |
| InChIKey | VQVMPNRLYIFKEP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |