C30H33N5O5S2 — CID 98359006
ethyl 2-[[(2R)-2-[[4-benzyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 98359006) has the molecular formula C30H33N5O5S2 and a molecular weight of 607.76 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-[[4-benzyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2R)-2-[[4-benzyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 98359006 |
| Molecular Formula | C30H33N5O5S2 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | ethyl 2-[[(2R)-2-[[4-benzyl-5-[(furan-2-carbonylamino)methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@@H](C)Sc2nnc(CNC(=O)c3ccco3)n2Cc2ccccc2)sc2c1CCCCC2 |
| InChI | InChI=1S/C30H33N5O5S2/c1-3-39-29(38)25-21-13-8-5-9-15-23(21)42-28(25)32-26(36)19(2)41-30-34-33-24(17-31-27(37)22-14-10-16-40-22)35(30)18-20-11-6-4-7-12-20/h4,6-7,10-12,14,16,19H,3,5,8-9,13,15,17-18H2,1-2H3,(H,31,37)(H,32,36)/t19-/m1/s1 |
| InChIKey | MASDRXSCFLHPFF-LJQANCHMSA-N |
| XLogP | 5.48 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |