C32H35N5O5S2 — CID 98229726
ethyl 2-[[(2S)-2-[[4-benzyl-5-[[(2-phenoxyacetyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 98229726) has the molecular formula C32H35N5O5S2 and a molecular weight of 633.80 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-[[4-benzyl-5-[[(2-phenoxyacetyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2S)-2-[[4-benzyl-5-[[(2-phenoxyacetyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 98229726 |
| Molecular Formula | C32H35N5O5S2 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | ethyl 2-[[(2S)-2-[[4-benzyl-5-[[(2-phenoxyacetyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@H](C)Sc2nnc(CNC(=O)COc3ccccc3)n2Cc2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C32H35N5O5S2/c1-3-41-31(40)28-24-16-10-11-17-25(24)44-30(28)34-29(39)21(2)43-32-36-35-26(37(32)19-22-12-6-4-7-13-22)18-33-27(38)20-42-23-14-8-5-9-15-23/h4-9,12-15,21H,3,10-11,16-20H2,1-2H3,(H,33,38)(H,34,39)/t21-/m0/s1 |
| InChIKey | GAZXQHFPSBGWOU-NRFANRHFSA-N |
| XLogP | 5.26 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |