C32H35N5O6S2 — CID 99656865
ethyl 2-[[(2R)-2-[[4-benzyl-5-[[(3,5-dimethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 99656865) has the molecular formula C32H35N5O6S2 and a molecular weight of 649.80 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-[[4-benzyl-5-[[(3,5-dimethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2R)-2-[[4-benzyl-5-[[(3,5-dimethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 99656865 |
| Molecular Formula | C32H35N5O6S2 |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | ethyl 2-[[(2R)-2-[[4-benzyl-5-[[(3,5-dimethoxybenzoyl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]propanoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@@H](C)Sc2nnc(CNC(=O)c3cc(OC)cc(OC)c3)n2Cc2ccccc2)sc2c1CCC2 |
| InChI | InChI=1S/C32H35N5O6S2/c1-5-43-31(40)27-24-12-9-13-25(24)45-30(27)34-28(38)19(2)44-32-36-35-26(37(32)18-20-10-7-6-8-11-20)17-33-29(39)21-14-22(41-3)16-23(15-21)42-4/h6-8,10-11,14-16,19H,5,9,12-13,17-18H2,1-4H3,(H,33,39)(H,34,38)/t19-/m1/s1 |
| InChIKey | MNCIAUYISOUZKJ-LJQANCHMSA-N |
| XLogP | 5.12 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |