C27H26N6O7S2 — CID 3349027
ethyl 2-[[2-[[5-[(furan-2-carbonylamino)methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3349027) has the molecular formula C27H26N6O7S2 and a molecular weight of 610.67 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(furan-2-carbonylamino)methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(furan-2-carbonylamino)methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3349027 |
| Molecular Formula | C27H26N6O7S2 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | ethyl 2-[[2-[[5-[(furan-2-carbonylamino)methyl]-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(CNC(=O)c3ccco3)n2-c2ccc([N+](=O)[O-])cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H26N6O7S2/c1-2-39-26(36)23-18-6-3-4-8-20(18)42-25(23)29-22(34)15-41-27-31-30-21(14-28-24(35)19-7-5-13-40-19)32(27)16-9-11-17(12-10-16)33(37)38/h5,7,9-13H,2-4,6,8,14-15H2,1H3,(H,28,35)(H,29,34) |
| InChIKey | GURPTNBCPFPALI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 171.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|