C18H13N3O4S3 — CID 45267962
N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-4-nitrobenzenesulfonamide (PubChem CID 45267962) has the molecular formula C18H13N3O4S3 and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 45267962 |
| Molecular Formula | C18H13N3O4S3 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1csc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H13N3O4S3/c1-11-10-26-18(16(11)17-19-14-4-2-3-5-15(14)27-17)20-28(24,25)13-8-6-12(7-9-13)21(22)23/h2-10,20H,1H3 |
| InChIKey | QWWWQGYXXHPFLG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|