C14H19N3O — CID 45268640
7-[(dimethylamino)methyl]-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one (PubChem CID 45268640) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 7-[(dimethylamino)methyl]-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one.
| Compound Name | 7-[(dimethylamino)methyl]-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 45268640 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 7-[(dimethylamino)methyl]-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one |
| SMILES | CN(C)Cc1ccc2c(c1)NC(=O)C1CCCN21 |
| InChI | InChI=1S/C14H19N3O/c1-16(2)9-10-5-6-12-11(8-10)15-14(18)13-4-3-7-17(12)13/h5-6,8,13H,3-4,7,9H2,1-2H3,(H,15,18) |
| InChIKey | GACYULOPBWQXQH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|