C16H14FNO3 — CID 45268871
2-[(4-fluoro-3-methylphenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one (PubChem CID 45268871) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-[(4-fluoro-3-methylphenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one.
| Compound Name | 2-[(4-fluoro-3-methylphenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 45268871 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[(4-fluoro-3-methylphenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
| SMILES | Cc1cc(CN2Cc3ccc(O)c(O)c3C2=O)ccc1F |
| InChI | InChI=1S/C16H14FNO3/c1-9-6-10(2-4-12(9)17)7-18-8-11-3-5-13(19)15(20)14(11)16(18)21/h2-6,19-20H,7-8H2,1H3 |
| InChIKey | RGHGVMXWTLTLOS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|