C15H9ClFNO4 — CID 25196811
2-[(3-chloro-4-fluorophenyl)methyl]-4,5-dihydroxyisoindole-1,3-dione (PubChem CID 25196811) has the molecular formula C15H9ClFNO4 and a molecular weight of 321.69 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-4,5-dihydroxyisoindole-1,3-dione.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-4,5-dihydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 25196811 |
| Molecular Formula | C15H9ClFNO4 |
| Molecular Weight | 321.69 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-4,5-dihydroxyisoindole-1,3-dione |
| SMILES | O=C1c2ccc(O)c(O)c2C(=O)N1Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H9ClFNO4/c16-9-5-7(1-3-10(9)17)6-18-14(21)8-2-4-11(19)13(20)12(8)15(18)22/h1-5,19-20H,6H2 |
| InChIKey | RZMMKEUISXPWCN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|