About 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione
4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 25197265) has the molecular formula C17H10F3N3O4
and a molecular weight of 377.28 g/mol. Its IUPAC name is 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione |
| PubChem CID | 25197265 |
| Molecular Formula | C17H10F3N3O4 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(O)c(O)c2C(=O)N1Cc1cccc(C2(C(F)(F)F)N=N2)c1 |
| InChI | InChI=1S/C17H10F3N3O4/c18-17(19,20)16(21-22-16)9-3-1-2-8(6-9)7-23-14(26)10-4-5-11(24)13(25)12(10)15(23)27/h1-6,24-25H,7H2 |
| InChIKey | IMCYLMGPDNNETL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione?
The IUPAC name of 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione (CID 25197265) is 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione.
What is the SMILES notation for 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione?
The canonical SMILES for 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione is O=C1c2ccc(O)c(O)c2C(=O)N1Cc1cccc(C2(C(F)(F)F)N=N2)c1.
What is the InChIKey of 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione?
The InChIKey is IMCYLMGPDNNETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F3N3O4/c18-17(19,20)16(21-22-16)9-3-1-2-8(6-9)7-23-14(26)10-4-5-11(24)13(25)12(10)15(23)27/h1-6,24-25H,7H2.
What are the key properties of 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione?
4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione has a molecular weight of 377.28 g/mol, XLogP of 3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-2-[[3-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]isoindole-1,3-dione is sourced from PubChem (CID 25197265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).