C16H13ClFNO4 — CID 144518868
2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-4-methyl-3H-isoindol-1-one (PubChem CID 144518868) has the molecular formula C16H13ClFNO4 and a molecular weight of 337.73 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-4-methyl-3H-isoindol-1-one.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-4-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 144518868 |
| Molecular Formula | C16H13ClFNO4 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-5,6,7-trihydroxy-4-methyl-3H-isoindol-1-one |
| SMILES | Cc1c(O)c(O)c(O)c2c1CN(Cc1ccc(F)c(Cl)c1)C2=O |
| InChI | InChI=1S/C16H13ClFNO4/c1-7-9-6-19(5-8-2-3-11(18)10(17)4-8)16(23)12(9)14(21)15(22)13(7)20/h2-4,20-22H,5-6H2,1H3 |
| InChIKey | XCFLMLHVQOJASN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|