C26H30ClFN4O4 — CID 59344745
5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-15-(2-pyrrolidin-1-ylethyl)-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione (PubChem CID 59344745) has the molecular formula C26H30ClFN4O4 and a molecular weight of 517.00 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-15-(2-pyrrolidin-1-ylethyl)-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-15-(2-pyrrolidin-1-ylethyl)-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
|---|---|
| PubChem CID | 59344745 |
| Molecular Formula | C26H30ClFN4O4 |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)methyl]-8-hydroxy-15-(2-pyrrolidin-1-ylethyl)-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
| SMILES | O=C1c2c(c3n(c(=O)c2O)CCCCN(CCN2CCCC2)C3=O)CCN1Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C26H30ClFN4O4/c27-19-15-17(5-6-20(19)28)16-31-12-7-18-21(24(31)34)23(33)26(36)32-11-4-3-10-30(25(35)22(18)32)14-13-29-8-1-2-9-29/h5-6,15,33H,1-4,7-14,16H2 |
| InChIKey | XRRISMQZNOJMKH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |