C24H25ClFN3O4 — CID 144561589
8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-methyl-3-[2-(2-methylcyclopropyl)ethyl]-9,10-dihydro-3H-imidazo[5,1-a][2,6]naphthyridine-1,5,7-trione (PubChem CID 144561589) has the molecular formula C24H25ClFN3O4 and a molecular weight of 473.93 g/mol. Its IUPAC name is 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-methyl-3-[2-(2-methylcyclopropyl)ethyl]-9,10-dihydro-3H-imidazo[5,1-a][2,6]naphthyridine-1,5,7-trione.
| Compound Name | 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-methyl-3-[2-(2-methylcyclopropyl)ethyl]-9,10-dihydro-3H-imidazo[5,1-a][2,6]naphthyridine-1,5,7-trione |
|---|---|
| PubChem CID | 144561589 |
| Molecular Formula | C24H25ClFN3O4 |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-methyl-3-[2-(2-methylcyclopropyl)ethyl]-9,10-dihydro-3H-imidazo[5,1-a][2,6]naphthyridine-1,5,7-trione |
| SMILES | CC1CC1CCC1N(C)C(=O)c2c3c(c(O)c(=O)n21)C(=O)N(Cc1ccc(F)c(Cl)c1)CC3 |
| InChI | InChI=1S/C24H25ClFN3O4/c1-12-9-14(12)4-6-18-27(2)23(32)20-15-7-8-28(11-13-3-5-17(26)16(25)10-13)22(31)19(15)21(30)24(33)29(18)20/h3,5,10,12,14,18,30H,4,6-9,11H2,1-2H3 |
| InChIKey | UNTZBHHENPEZNT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |