C26H23ClFN3O5 — CID 123748164
8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(2-hydroxypropyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-yne]-1,5,7-trione (PubChem CID 123748164) has the molecular formula C26H23ClFN3O5 and a molecular weight of 511.94 g/mol. Its IUPAC name is 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(2-hydroxypropyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-yne]-1,5,7-trione.
| Compound Name | 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(2-hydroxypropyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-yne]-1,5,7-trione |
|---|---|
| PubChem CID | 123748164 |
| Molecular Formula | C26H23ClFN3O5 |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 8-[(3-chloro-4-fluorophenyl)methyl]-6-hydroxy-2-(2-hydroxypropyl)spiro[9,10-dihydroimidazo[5,1-a][2,6]naphthyridine-3,2'-bicyclo[3.2.0]hept-6-yne]-1,5,7-trione |
| SMILES | CC(O)CN1C(=O)c2c3c(c(O)c(=O)n2C12CCC1C#CC12)C(=O)N(Cc1ccc(F)c(Cl)c1)CC3 |
| InChI | InChI=1S/C26H23ClFN3O5/c1-13(32)11-30-24(35)21-16-7-9-29(12-14-2-5-19(28)18(27)10-14)23(34)20(16)22(33)25(36)31(21)26(30)8-6-15-3-4-17(15)26/h2,5,10,13,15,17,32-33H,6-9,11-12H2,1H3 |
| InChIKey | VWBVNSVLTYXLRL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|