C23H25ClFN3O5 — CID 54735108
(13S)-5-[(3-chloro-4-fluorophenyl)methyl]-8,13-dihydroxy-12,12,15-trimethyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione (PubChem CID 54735108) has the molecular formula C23H25ClFN3O5 and a molecular weight of 477.92 g/mol. Its IUPAC name is (13S)-5-[(3-chloro-4-fluorophenyl)methyl]-8,13-dihydroxy-12,12,15-trimethyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione.
| Compound Name | (13S)-5-[(3-chloro-4-fluorophenyl)methyl]-8,13-dihydroxy-12,12,15-trimethyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
|---|---|
| PubChem CID | 54735108 |
| Molecular Formula | C23H25ClFN3O5 |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (13S)-5-[(3-chloro-4-fluorophenyl)methyl]-8,13-dihydroxy-12,12,15-trimethyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
| SMILES | CN1C[C@@H](O)C(C)(C)Cn2c(c3c(c(O)c2=O)C(=O)N(Cc2ccc(F)c(Cl)c2)CC3)C1=O |
| InChI | InChI=1S/C23H25ClFN3O5/c1-23(2)11-28-18(21(32)26(3)10-16(23)29)13-6-7-27(20(31)17(13)19(30)22(28)33)9-12-4-5-15(25)14(24)8-12/h4-5,8,16,29-30H,6-7,9-11H2,1-3H3/t16-/m1/s1 |
| InChIKey | BJZBXZKAQGBGHH-MRXNPFEDSA-N |
| XLogP | 2.02 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |